C19H31NO4S — CID 87063688
1-(3,4-dihydro-1H-isoquinolin-2-yl)decan-2-yl hydrogen sulfate (PubChem CID 87063688) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-yl)decan-2-yl hydrogen sulfate.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)decan-2-yl hydrogen sulfate |
|---|---|
| PubChem CID | 87063688 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-yl)decan-2-yl hydrogen sulfate |
| SMILES | CCCCCCCCC(CN1CCc2ccccc2C1)OS(=O)(=O)O |
| InChI | InChI=1S/C19H31NO4S/c1-2-3-4-5-6-7-12-19(24-25(21,22)23)16-20-14-13-17-10-8-9-11-18(17)15-20/h8-11,19H,2-7,12-16H2,1H3,(H,21,22,23) |
| InChIKey | KNSGYSDYFPVRQU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|