C26H45NO5S — CID 91120443
[1-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methyl-3-nonoxyheptan-2-yl] hydrogen sulfate (PubChem CID 91120443) has the molecular formula C26H45NO5S and a molecular weight of 483.72 g/mol. Its IUPAC name is [1-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methyl-3-nonoxyheptan-2-yl] hydrogen sulfate.
| Compound Name | [1-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methyl-3-nonoxyheptan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 91120443 |
| Molecular Formula | C26H45NO5S |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | [1-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methyl-3-nonoxyheptan-2-yl] hydrogen sulfate |
| SMILES | CCCCCCCCCOC(C(C)CCC)C(CN1CCc2ccccc2C1)OS(=O)(=O)O |
| InChI | InChI=1S/C26H45NO5S/c1-4-6-7-8-9-10-13-19-31-26(22(3)14-5-2)25(32-33(28,29)30)21-27-18-17-23-15-11-12-16-24(23)20-27/h11-12,15-16,22,25-26H,4-10,13-14,17-21H2,1-3H3,(H,28,29,30) |
| InChIKey | VPFYRCPTUOOBNX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|