C28H47NO5S — CID 172765670
[1-(3,4-dihydroisoquinolin-2-ium-2-yl)-3-(2-hexyldecoxy)propan-2-yl] sulfate (PubChem CID 172765670) has the molecular formula C28H47NO5S and a molecular weight of 509.75 g/mol. Its IUPAC name is [1-(3,4-dihydroisoquinolin-2-ium-2-yl)-3-(2-hexyldecoxy)propan-2-yl] sulfate.
| Compound Name | [1-(3,4-dihydroisoquinolin-2-ium-2-yl)-3-(2-hexyldecoxy)propan-2-yl] sulfate |
|---|---|
| PubChem CID | 172765670 |
| Molecular Formula | C28H47NO5S |
| Molecular Weight | 509.75 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | [1-(3,4-dihydroisoquinolin-2-ium-2-yl)-3-(2-hexyldecoxy)propan-2-yl] sulfate |
| SMILES | CCCCCCCCC(CCCCCC)COCC(C[N+]1=Cc2ccccc2CC1)OS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H47NO5S/c1-3-5-7-9-10-12-16-25(15-11-8-6-4-2)23-33-24-28(34-35(30,31)32)22-29-20-19-26-17-13-14-18-27(26)21-29/h13-14,17-18,21,25,28H,3-12,15-16,19-20,22-24H2,1-2H3 |
| InChIKey | MGVUEPATDLBLAJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|