C41H54ClN11O8 — CID 158222236
tert-butyl N-[1-(2-chloropyrimidin-4-yl)piperidin-3-yl]carbamate;tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate;2-nitroaniline (PubChem CID 158222236) has the molecular formula C41H54ClN11O8 and a molecular weight of 864.41 g/mol. Its IUPAC name is tert-butyl N-[1-(2-chloropyrimidin-4-yl)piperidin-3-yl]carbamate;tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate;2-nitroaniline.
| Compound Name | tert-butyl N-[1-(2-chloropyrimidin-4-yl)piperidin-3-yl]carbamate;tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate;2-nitroaniline |
|---|---|
| PubChem CID | 158222236 |
| Molecular Formula | C41H54ClN11O8 |
| Molecular Weight | 864.41 g/mol |
| Exact Mass | 863.38 |
| IUPAC Name | tert-butyl N-[1-(2-chloropyrimidin-4-yl)piperidin-3-yl]carbamate;tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate;2-nitroaniline |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2ccnc(Cc3ccccc3[N+](=O)[O-])n2)C1.CC(C)(C)OC(=O)NC1CCCN(c2ccnc(Cl)n2)C1.Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H27N5O4.C14H21ClN4O2.C6H6N2O2/c1-21(2,3)30-20(27)23-16-8-6-12-25(14-16)19-10-11-22-18(24-19)13-15-7-4-5-9-17(15)26(28)29;1-14(2,3)21-13(20)17-10-5-4-8-19(9-10)11-6-7-16-12(15)18-11;7-5-3-1-2-4-6(5)8(9)10/h4-5,7,9-11,16H,6,8,12-14H2,1-3H3,(H,23,27);6-7,10H,4-5,8-9H2,1-3H3,(H,17,20);1-4H,7H2 |
| InChIKey | GDJLBPIXLVKKMW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 247.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.41 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|