C12H19LiN2 — CID 15822463
lithium N,N,N'-trimethyl-N'-(phenylmethyl)ethane-1,2-diamine (PubChem CID 15822463) has the molecular formula C12H19LiN2 and a molecular weight of 198.24 g/mol. Its IUPAC name is lithium N,N,N'-trimethyl-N'-(phenylmethyl)ethane-1,2-diamine.
| Compound Name | lithium N,N,N'-trimethyl-N'-(phenylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 15822463 |
| Molecular Formula | C12H19LiN2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | lithium N,N,N'-trimethyl-N'-(phenylmethyl)ethane-1,2-diamine |
| SMILES | CN(C)CCN(C)Cc1[c-]cccc1.[Li+] |
| InChI | InChI=1S/C12H19N2.Li/c1-13(2)9-10-14(3)11-12-7-5-4-6-8-12;/h4-7H,9-11H2,1-3H3;/q-1;+1 |
| InChIKey | BESBNQFZKNCCNN-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|