C22H35LiN4Si — CID 135049431
lithium N'-[[2-(dimethylamino)ethyl-methylamino]-phenyl-phenylsilyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 135049431) has the molecular formula C22H35LiN4Si and a molecular weight of 390.58 g/mol. Its IUPAC name is lithium N'-[[2-(dimethylamino)ethyl-methylamino]-phenyl-phenylsilyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | lithium N'-[[2-(dimethylamino)ethyl-methylamino]-phenyl-phenylsilyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 135049431 |
| Molecular Formula | C22H35LiN4Si |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | lithium N'-[[2-(dimethylamino)ethyl-methylamino]-phenyl-phenylsilyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)[Si](c1[c-]cccc1)(c1ccccc1)N(C)CCN(C)C.[Li+] |
| InChI | InChI=1S/C22H35N4Si.Li/c1-23(2)17-19-25(5)27(21-13-9-7-10-14-21,22-15-11-8-12-16-22)26(6)20-18-24(3)4;/h7-15H,17-20H2,1-6H3;/q-1;+1 |
| InChIKey | FGBUJYMDNSFBNN-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|