C15H10N3O+ — CID 158224774
11-oxa-6,9-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene (PubChem CID 158224774) has the molecular formula C15H10N3O+ and a molecular weight of 248.27 g/mol. Its IUPAC name is 11-oxa-6,9-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene.
| Compound Name | 11-oxa-6,9-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene |
|---|---|
| PubChem CID | 158224774 |
| Molecular Formula | C15H10N3O+ |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 11-oxa-6,9-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene |
| SMILES | c1ccc2c(c1)C[n+]1c-2oc2c1cc1cnccn12 |
| InChI | InChI=1S/C15H10N3O/c1-2-4-12-10(3-1)9-18-13-7-11-8-16-5-6-17(11)15(13)19-14(12)18/h1-8H,9H2/q+1 |
| InChIKey | LGXDUKPZOIDUFV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|