C22H16N3+ — CID 161141063
11-phenyl-9,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene (PubChem CID 161141063) has the molecular formula C22H16N3+ and a molecular weight of 322.39 g/mol. Its IUPAC name is 11-phenyl-9,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene.
| Compound Name | 11-phenyl-9,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene |
|---|---|
| PubChem CID | 161141063 |
| Molecular Formula | C22H16N3+ |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 11-phenyl-9,11-diaza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),3,5,7,13,15,17-octaene |
| SMILES | c1ccc(-n2c3[n+](c4cc5ccccn5c42)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H16N3/c1-2-9-17(10-3-1)25-21-19-12-5-4-8-16(19)15-24(21)20-14-18-11-6-7-13-23(18)22(20)25/h1-14H,15H2/q+1 |
| InChIKey | QSSXQYWKVYHKKJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 13.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|