C15H9N2OS+ — CID 159405624
11-oxa-3-thia-6-aza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene (PubChem CID 159405624) has the molecular formula C15H9N2OS+ and a molecular weight of 265.32 g/mol. Its IUPAC name is 11-oxa-3-thia-6-aza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene.
| Compound Name | 11-oxa-3-thia-6-aza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene |
|---|---|
| PubChem CID | 159405624 |
| Molecular Formula | C15H9N2OS+ |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 11-oxa-3-thia-6-aza-1-azoniapentacyclo[10.7.0.02,10.04,9.013,18]nonadeca-1(12),2(10),4(9),5,7,13,15,17-octaene |
| SMILES | c1ccc2c(c1)C[n+]1c-2oc2c3ccncc3sc21 |
| InChI | InChI=1S/C15H9N2OS/c1-2-4-10-9(3-1)8-17-14(10)18-13-11-5-6-16-7-12(11)19-15(13)17/h1-7H,8H2/q+1 |
| InChIKey | CNAQSHYKSVODLO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|