C14H8N3OS+ — CID 159515079
11-oxa-9-thia-5,15-diaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene (PubChem CID 159515079) has the molecular formula C14H8N3OS+ and a molecular weight of 266.31 g/mol. Its IUPAC name is 11-oxa-9-thia-5,15-diaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene.
| Compound Name | 11-oxa-9-thia-5,15-diaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
|---|---|
| PubChem CID | 159515079 |
| Molecular Formula | C14H8N3OS+ |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 11-oxa-9-thia-5,15-diaza-1-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1(12),2(10),3(8),4,6,13(18),14,16-octaene |
| SMILES | c1cc2c(cn1)-c1oc3sc4ccncc4c3[n+]1C2 |
| InChI | InChI=1S/C14H8N3OS/c1-3-15-5-9-8(1)7-17-12-10-6-16-4-2-11(10)19-14(12)18-13(9)17/h1-6H,7H2/q+1 |
| InChIKey | ZVEAXRVMNBHVSQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|