C17H11Cl3N2O2 — CID 158228178
1-(2-chloro-3-pyridinyl)-3-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]propan-1-one (PubChem CID 158228178) has the molecular formula C17H11Cl3N2O2 and a molecular weight of 381.65 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]propan-1-one.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 158228178 |
| Molecular Formula | C17H11Cl3N2O2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]propan-1-one |
| SMILES | O=C(CCc1cc(-c2ccc(Cl)cc2Cl)no1)c1cccnc1Cl |
| InChI | InChI=1S/C17H11Cl3N2O2/c18-10-3-5-12(14(19)8-10)15-9-11(24-22-15)4-6-16(23)13-2-1-7-21-17(13)20/h1-3,5,7-9H,4,6H2 |
| InChIKey | IPSLKZQMJOJCQG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|