About 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane
3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane (PubChem CID 158228783) has the molecular formula C25H42N2O
and a molecular weight of 386.62 g/mol. Its IUPAC name is 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane.
Molecular Properties
| Compound Name | 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane |
| PubChem CID | 158228783 |
| Molecular Formula | C25H42N2O |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane |
| SMILES | CC(C)(C)c1ccc[n+]([O-])c1.CC(C)(C)c1cccnc1C(C)(C)C.CCC |
| InChI | InChI=1S/C13H21N.C9H13NO.C3H8/c1-12(2,3)10-8-7-9-14-11(10)13(4,5)6;1-9(2,3)8-5-4-6-10(11)7-8;1-3-2/h7-9H,1-6H3;4-7H,1-3H3;3H2,1-2H3 |
| InChIKey | GECXOSKDSQXAKR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane?
The IUPAC name of 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane (CID 158228783) is 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane.
What is the SMILES notation for 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane?
The canonical SMILES for 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane is CC(C)(C)c1ccc[n+]([O-])c1.CC(C)(C)c1cccnc1C(C)(C)C.CCC.
What is the InChIKey of 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane?
The InChIKey is GECXOSKDSQXAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N.C9H13NO.C3H8/c1-12(2,3)10-8-7-9-14-11(10)13(4,5)6;1-9(2,3)8-5-4-6-10(11)7-8;1-3-2/h7-9H,1-6H3;4-7H,1-3H3;3H2,1-2H3.
What are the key properties of 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane?
3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane has a molecular weight of 386.62 g/mol, XLogP of 6.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-oxidopyridin-1-ium;2,3-ditert-butylpyridine;propane is sourced from PubChem (CID 158228783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).