C38H57BN4O11P2 — CID 158232994
CID 158232994 (PubChem CID 158232994) has the molecular formula C38H57BN4O11P2 and a molecular weight of 818.65 g/mol.
| Compound Name | CID 158232994 |
|---|---|
| PubChem CID | 158232994 |
| Molecular Formula | C38H57BN4O11P2 |
| Molecular Weight | 818.65 g/mol |
| Exact Mass | 818.36 |
| IUPAC Name | — |
| SMILES | CC(C)CC(CC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)[B-]12OC3(CCCC3)C[N+]1(CCCC(=O)CC(P(=O)(O)O)P(=O)(O)O)CC1(CCCC1)O2 |
| InChI | InChI=1S/C38H57BN4O11P2/c1-28(2)21-30(23-34(45)32(22-29-11-4-3-5-12-29)42-36(46)33-25-40-18-19-41-33)39-43(26-37(53-39)14-6-7-15-37,27-38(54-39)16-8-9-17-38)20-10-13-31(44)24-35(55(47,48)49)56(50,51)52/h3-5,11-12,18-19,25,28,30,32,35H,6-10,13-17,20-24,26-27H2,1-2H3,(H,42,46)(H2,47,48,49)(H2,50,51,52)/t30?,32-,39?,43?/m0/s1 |
| InChIKey | JDLIWPANQOYMGH-LVQVUXFASA-N |
| XLogP | 5.06 |
| TPSA | 222.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|