C24H32B3BrN4O6 — CID 158238138
2-bromopyridine-4-carbonitrile;(4-cyano-2-pyridinyl)boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 158238138) has the molecular formula C24H32B3BrN4O6 and a molecular weight of 584.88 g/mol. Its IUPAC name is 2-bromopyridine-4-carbonitrile;(4-cyano-2-pyridinyl)boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 2-bromopyridine-4-carbonitrile;(4-cyano-2-pyridinyl)boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158238138 |
| Molecular Formula | C24H32B3BrN4O6 |
| Molecular Weight | 584.88 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 2-bromopyridine-4-carbonitrile;(4-cyano-2-pyridinyl)boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.N#Cc1ccnc(B(O)O)c1.N#Cc1ccnc(Br)c1 |
| InChI | InChI=1S/C12H24B2O4.C6H5BN2O2.C6H3BrN2/c1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14;8-4-5-1-2-9-6(3-5)7(10)11;7-6-3-5(4-8)1-2-9-6/h1-8H3;1-3,10-11H;1-3H |
| InChIKey | GFFJTHUPLHGZFY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.88 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|