C28H35B2BrF6N2O4 — CID 165055186
2-bromo-5-(trifluoromethyl)pyridine;2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-5-(trifluoromethyl)pyridine (PubChem CID 165055186) has the molecular formula C28H35B2BrF6N2O4 and a molecular weight of 679.11 g/mol. Its IUPAC name is 2-bromo-5-(trifluoromethyl)pyridine;2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-bromo-5-(trifluoromethyl)pyridine;2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 165055186 |
| Molecular Formula | C28H35B2BrF6N2O4 |
| Molecular Weight | 679.11 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 2-bromo-5-(trifluoromethyl)pyridine;2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-5-(trifluoromethyl)pyridine |
| SMILES | C=CB1OC(C)(C)C(C)(C)O1.CC1(C)OB(/C=C/c2ccc(C(F)(F)F)cn2)OC1(C)C.FC(F)(F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C14H17BF3NO2.C8H15BO2.C6H3BrF3N/c1-12(2)13(3,4)21-15(20-12)8-7-11-6-5-10(9-19-11)14(16,17)18;1-6-9-10-7(2,3)8(4,5)11-9;7-5-2-1-4(3-11-5)6(8,9)10/h5-9H,1-4H3;6H,1H2,2-5H3;1-3H/b8-7+;; |
| InChIKey | QHKBTQLTSAZGGK-MIIBGCIDSA-N |
| XLogP | 8.41 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.11 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|