C20H16BBrF12N2O2 — CID 164557869
5-bromo-2,4-bis(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4-bis(trifluoromethyl)pyridine (PubChem CID 164557869) has the molecular formula C20H16BBrF12N2O2 and a molecular weight of 635.05 g/mol. Its IUPAC name is 5-bromo-2,4-bis(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4-bis(trifluoromethyl)pyridine.
| Compound Name | 5-bromo-2,4-bis(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 164557869 |
| Molecular Formula | C20H16BBrF12N2O2 |
| Molecular Weight | 635.05 g/mol |
| Exact Mass | 634.03 |
| IUPAC Name | 5-bromo-2,4-bis(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,4-bis(trifluoromethyl)pyridine |
| SMILES | CC1(C)OB(c2cnc(C(F)(F)F)cc2C(F)(F)F)OC1(C)C.FC(F)(F)c1cc(C(F)(F)F)c(Br)cn1 |
| InChI | InChI=1S/C13H14BF6NO2.C7H2BrF6N/c1-10(2)11(3,4)23-14(22-10)8-6-21-9(13(18,19)20)5-7(8)12(15,16)17;8-4-2-15-5(7(12,13)14)1-3(4)6(9,10)11/h5-6H,1-4H3;1-2H |
| InChIKey | JIDFBXOENQDJGR-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.05 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|