C24H30B3BrF8N2O6 — CID 159626340
5-bromo-3-fluoro-2-(trifluoromethyl)pyridine;[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 159626340) has the molecular formula C24H30B3BrF8N2O6 and a molecular weight of 706.84 g/mol. Its IUPAC name is 5-bromo-3-fluoro-2-(trifluoromethyl)pyridine;[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 5-bromo-3-fluoro-2-(trifluoromethyl)pyridine;[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159626340 |
| Molecular Formula | C24H30B3BrF8N2O6 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.14 |
| IUPAC Name | 5-bromo-3-fluoro-2-(trifluoromethyl)pyridine;[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]boronic acid;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.Fc1cc(Br)cnc1C(F)(F)F.OB(O)c1cnc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C12H24B2O4.C6H4BF4NO2.C6H2BrF4N/c1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14;8-4-1-3(7(13)14)2-12-5(4)6(9,10)11;7-3-1-4(8)5(12-2-3)6(9,10)11/h1-8H3;1-2,13-14H;1-2H |
| InChIKey | MONRKFKSLFYVPM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|