C17H30N2 — CID 158239559
1-buta-1,3-dien-2-yl-N-tert-butyl-N-(cyclopropylmethyl)piperidin-3-amine (PubChem CID 158239559) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-N-tert-butyl-N-(cyclopropylmethyl)piperidin-3-amine.
| Compound Name | 1-buta-1,3-dien-2-yl-N-tert-butyl-N-(cyclopropylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 158239559 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-N-tert-butyl-N-(cyclopropylmethyl)piperidin-3-amine |
| SMILES | C=CC(=C)N1CCCC(N(CC2CC2)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H30N2/c1-6-14(2)18-11-7-8-16(13-18)19(17(3,4)5)12-15-9-10-15/h6,15-16H,1-2,7-13H2,3-5H3 |
| InChIKey | UVXDRXYDTDYDJH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|