C14H26N2 — CID 159678913
(3S)-1-buta-1,3-dien-2-yl-N-tert-butyl-N-methylpiperidin-3-amine (PubChem CID 159678913) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (3S)-1-buta-1,3-dien-2-yl-N-tert-butyl-N-methylpiperidin-3-amine.
| Compound Name | (3S)-1-buta-1,3-dien-2-yl-N-tert-butyl-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 159678913 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (3S)-1-buta-1,3-dien-2-yl-N-tert-butyl-N-methylpiperidin-3-amine |
| SMILES | C=CC(=C)N1CCC[C@H](N(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H26N2/c1-7-12(2)16-10-8-9-13(11-16)15(6)14(3,4)5/h7,13H,1-2,8-11H2,3-6H3/t13-/m0/s1 |
| InChIKey | NCAYKYFIAXLYJQ-ZDUSSCGKSA-N |
| XLogP | 2.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|