C10H18N2 — CID 167089477
1-buta-1,3-dien-2-yl-2,4-dimethylpiperazine (PubChem CID 167089477) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-2,4-dimethylpiperazine.
| Compound Name | 1-buta-1,3-dien-2-yl-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 167089477 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-2,4-dimethylpiperazine |
| SMILES | C=CC(=C)N1CCN(C)CC1C |
| InChI | InChI=1S/C10H18N2/c1-5-9(2)12-7-6-11(4)8-10(12)3/h5,10H,1-2,6-8H2,3-4H3 |
| InChIKey | XEALZVLROXNOKN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|