C11H20N2 — CID 143504867
1-buta-1,3-dien-2-yl-4-propylpiperazine (PubChem CID 143504867) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-4-propylpiperazine.
| Compound Name | 1-buta-1,3-dien-2-yl-4-propylpiperazine |
|---|---|
| PubChem CID | 143504867 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-4-propylpiperazine |
| SMILES | C=CC(=C)N1CCN(CCC)CC1 |
| InChI | InChI=1S/C11H20N2/c1-4-6-12-7-9-13(10-8-12)11(3)5-2/h5H,2-4,6-10H2,1H3 |
| InChIKey | SNKNVJQKQNHLQI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|