C12H22N2 — CID 167150955
N,N-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-amine (PubChem CID 167150955) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-amine.
| Compound Name | N,N-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 167150955 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N,N-dimethyl-1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-amine |
| SMILES | C=C(/C=C\C)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C12H22N2/c1-5-6-11(2)14-9-7-12(8-10-14)13(3)4/h5-6,12H,2,7-10H2,1,3-4H3/b6-5- |
| InChIKey | INRMKDQGNBGKEJ-WAYWQWQTSA-N |
| XLogP | 2.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|