C11H16N2 — CID 59886144
1-[(1Z,3Z)-4-isocyanopenta-1,3-dienyl]piperidine (PubChem CID 59886144) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-[(1Z,3Z)-4-isocyanopenta-1,3-dienyl]piperidine.
| Compound Name | 1-[(1Z,3Z)-4-isocyanopenta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 59886144 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-[(1Z,3Z)-4-isocyanopenta-1,3-dienyl]piperidine |
| SMILES | [C-]#[N+]/C(C)=C\C=C/N1CCCCC1 |
| InChI | InChI=1S/C11H16N2/c1-11(12-2)7-6-10-13-8-4-3-5-9-13/h6-7,10H,3-5,8-9H2,1H3/b10-6-,11-7- |
| InChIKey | MXSFFMYWCWUZDC-SQXCDDPUSA-N |
| XLogP | 2.81 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|