C23H24F4N6O — CID 158242338
cyclopropyl-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-(difluoromethyl)-5-[[1-(3,4-difluorophenyl)-1,2,4-triazol-3-yl]amino]phenyl]piperazin-1-yl]methanone;molecular hydrogen (PubChem CID 158242338) has the molecular formula C23H24F4N6O and a molecular weight of 484.53 g/mol. Its IUPAC name is cyclopropyl-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-(difluoromethyl)-5-[[1-(3,4-difluorophenyl)-1,2,4-triazol-3-yl]amino]phenyl]piperazin-1-yl]methanone;molecular hydrogen.
| Compound Name | cyclopropyl-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-(difluoromethyl)-5-[[1-(3,4-difluorophenyl)-1,2,4-triazol-3-yl]amino]phenyl]piperazin-1-yl]methanone;molecular hydrogen |
|---|---|
| PubChem CID | 158242338 |
| Molecular Formula | C23H24F4N6O |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | cyclopropyl-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-(difluoromethyl)-5-[[1-(3,4-difluorophenyl)-1,2,4-triazol-3-yl]amino]phenyl]piperazin-1-yl]methanone;molecular hydrogen |
| SMILES | [2H]C1([2H])N(C(=O)C2CC2)C([2H])([2H])C([2H])([2H])N(c2cc(Nc3ncn(-c4ccc(F)c(F)c4)n3)cc(C(F)F)c2)C1([2H])[2H].[H][H] |
| InChI | InChI=1S/C23H22F4N6O.H2/c24-19-4-3-17(12-20(19)25)33-13-28-23(30-33)29-16-9-15(21(26)27)10-18(11-16)31-5-7-32(8-6-31)22(34)14-1-2-14;/h3-4,9-14,21H,1-2,5-8H2,(H,29,30);1H/i5D2,6D2,7D2,8D2; |
| InChIKey | GFRSQBNBWBXDNQ-CADLHFACSA-N |
| XLogP | 4.53 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |