C20H21F4N5 — CID 158759187
N-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)-5-(trifluoromethyl)phenyl]-1-(3-fluorophenyl)-1,2,4-triazol-3-amine;molecular hydrogen (PubChem CID 158759187) has the molecular formula C20H21F4N5 and a molecular weight of 417.48 g/mol. Its IUPAC name is N-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)-5-(trifluoromethyl)phenyl]-1-(3-fluorophenyl)-1,2,4-triazol-3-amine;molecular hydrogen.
| Compound Name | N-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)-5-(trifluoromethyl)phenyl]-1-(3-fluorophenyl)-1,2,4-triazol-3-amine;molecular hydrogen |
|---|---|
| PubChem CID | 158759187 |
| Molecular Formula | C20H21F4N5 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[3-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)-5-(trifluoromethyl)phenyl]-1-(3-fluorophenyl)-1,2,4-triazol-3-amine;molecular hydrogen |
| SMILES | [2H]C1([2H])N(c2cc(Nc3ncn(-c4cccc(F)c4)n3)cc(C(F)(F)F)c2)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H].[H][H] |
| InChI | InChI=1S/C20H19F4N5.H2/c21-15-5-4-6-17(11-15)29-13-25-19(27-29)26-16-9-14(20(22,23)24)10-18(12-16)28-7-2-1-3-8-28;/h4-6,9-13H,1-3,7-8H2,(H,26,27);1H/i1D2,2D2,3D2,7D2,8D2; |
| InChIKey | IOLIHGKPXSGRRS-YAXTXBKCSA-N |
| XLogP | 5.41 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |