C19H16F6N2 — CID 158244585
4-[3-(1H-indol-3-yl)propyl]-3,5-bis(trifluoromethyl)aniline (PubChem CID 158244585) has the molecular formula C19H16F6N2 and a molecular weight of 386.34 g/mol. Its IUPAC name is 4-[3-(1H-indol-3-yl)propyl]-3,5-bis(trifluoromethyl)aniline.
| Compound Name | 4-[3-(1H-indol-3-yl)propyl]-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 158244585 |
| Molecular Formula | C19H16F6N2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[3-(1H-indol-3-yl)propyl]-3,5-bis(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)c(CCCc2c[nH]c3ccccc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F6N2/c20-18(21,22)15-8-12(26)9-16(19(23,24)25)14(15)6-3-4-11-10-27-17-7-2-1-5-13(11)17/h1-2,5,7-10,27H,3-4,6,26H2 |
| InChIKey | GFYSLWZVPVNYQK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|