C18H15F6N3 — CID 59493269
1-N-[2-(1H-indol-3-yl)ethyl]-2,6-bis(trifluoromethyl)benzene-1,4-diamine (PubChem CID 59493269) has the molecular formula C18H15F6N3 and a molecular weight of 387.33 g/mol. Its IUPAC name is 1-N-[2-(1H-indol-3-yl)ethyl]-2,6-bis(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-[2-(1H-indol-3-yl)ethyl]-2,6-bis(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 59493269 |
| Molecular Formula | C18H15F6N3 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-N-[2-(1H-indol-3-yl)ethyl]-2,6-bis(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1cc(C(F)(F)F)c(NCCc2c[nH]c3ccccc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F6N3/c19-17(20,21)13-7-11(25)8-14(18(22,23)24)16(13)26-6-5-10-9-27-15-4-2-1-3-12(10)15/h1-4,7-9,26-27H,5-6,25H2 |
| InChIKey | WNVNLMBRBVKFDF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|