C18H15F3N2O2 — CID 170655480
2-[2-(1H-indol-3-yl)ethylamino]-6-(trifluoromethyl)benzoic acid (PubChem CID 170655480) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethylamino]-6-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[2-(1H-indol-3-yl)ethylamino]-6-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170655480 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethylamino]-6-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1c(NCCc2c[nH]c3ccccc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C18H15F3N2O2/c19-18(20,21)13-5-3-7-15(16(13)17(24)25)22-9-8-11-10-23-14-6-2-1-4-12(11)14/h1-7,10,22-23H,8-9H2,(H,24,25) |
| InChIKey | UZDDNZVUUUVEHE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |