C29H42N4O7 — CID 158248675
[(E,4S)-2-oxonon-5-en-4-yl] (2S)-2-[[(Z)-2-[[6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridine-2-carbonyl]amino]but-2-enoyl]amino]butanoate (PubChem CID 158248675) has the molecular formula C29H42N4O7 and a molecular weight of 558.68 g/mol. Its IUPAC name is [(E,4S)-2-oxonon-5-en-4-yl] (2S)-2-[[(Z)-2-[[6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridine-2-carbonyl]amino]but-2-enoyl]amino]butanoate.
| Compound Name | [(E,4S)-2-oxonon-5-en-4-yl] (2S)-2-[[(Z)-2-[[6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridine-2-carbonyl]amino]but-2-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 158248675 |
| Molecular Formula | C29H42N4O7 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | [(E,4S)-2-oxonon-5-en-4-yl] (2S)-2-[[(Z)-2-[[6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyridine-2-carbonyl]amino]but-2-enoyl]amino]butanoate |
| SMILES | C/C=C(\NC(=O)c1cccc(CNC(=O)OC(C)(C)C)n1)C(=O)N[C@@H](CC)C(=O)O[C@H](/C=C/CCC)CC(C)=O |
| InChI | InChI=1S/C29H42N4O7/c1-8-11-12-15-21(17-19(4)34)39-27(37)23(10-3)33-25(35)22(9-2)32-26(36)24-16-13-14-20(31-24)18-30-28(38)40-29(5,6)7/h9,12-16,21,23H,8,10-11,17-18H2,1-7H3,(H,30,38)(H,32,36)(H,33,35)/b15-12+,22-9-/t21-,23+/m1/s1 |
| InChIKey | PIXWAHMVRYJCJH-QZXHMXMWSA-N |
| XLogP | 3.88 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|