C24H33FN4O6 — CID 158112336
(E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-5-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid (PubChem CID 158112336) has the molecular formula C24H33FN4O6 and a molecular weight of 492.55 g/mol. Its IUPAC name is (E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-5-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid.
| Compound Name | (E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-5-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid |
|---|---|
| PubChem CID | 158112336 |
| Molecular Formula | C24H33FN4O6 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-5-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid |
| SMILES | C/C=C(\NC(=O)c1ccc(F)c(CN)n1)C(=O)N[C@H](C(=O)O[C@H](/C=C/CCC)CC(=O)O)C(C)C |
| InChI | InChI=1S/C24H33FN4O6/c1-5-7-8-9-15(12-20(30)31)35-24(34)21(14(3)4)29-22(32)17(6-2)28-23(33)18-11-10-16(25)19(13-26)27-18/h6,8-11,14-15,21H,5,7,12-13,26H2,1-4H3,(H,28,33)(H,29,32)(H,30,31)/b9-8+,17-6-/t15-,21+/m1/s1 |
| InChIKey | ARMJUJFDZJYUNT-BHUGULGISA-N |
| XLogP | 2.20 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|