C25H36N4O6S — CID 162232730
(E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-methylsulfanylpyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid (PubChem CID 162232730) has the molecular formula C25H36N4O6S and a molecular weight of 520.65 g/mol. Its IUPAC name is (E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-methylsulfanylpyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid.
| Compound Name | (E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-methylsulfanylpyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid |
|---|---|
| PubChem CID | 162232730 |
| Molecular Formula | C25H36N4O6S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (E,3S)-3-[(2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-methylsulfanylpyridine-2-carbonyl]amino]but-2-enoyl]amino]-3-methylbutanoyl]oxyoct-4-enoic acid |
| SMILES | C/C=C(\NC(=O)c1nc(CN)ccc1SC)C(=O)N[C@H](C(=O)O[C@H](/C=C/CCC)CC(=O)O)C(C)C |
| InChI | InChI=1S/C25H36N4O6S/c1-6-8-9-10-17(13-20(30)31)35-25(34)21(15(3)4)29-23(32)18(7-2)28-24(33)22-19(36-5)12-11-16(14-26)27-22/h7,9-12,15,17,21H,6,8,13-14,26H2,1-5H3,(H,28,33)(H,29,32)(H,30,31)/b10-9+,18-7-/t17-,21+/m1/s1 |
| InChIKey | HUYKHGZEXDAUDX-NZMQYUCLSA-N |
| XLogP | 2.78 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|