C14H25NO3 — CID 160517729
[(E,4S)-2-oxonon-5-en-4-yl] (2R)-2-amino-3-methylbutanoate (PubChem CID 160517729) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is [(E,4S)-2-oxonon-5-en-4-yl] (2R)-2-amino-3-methylbutanoate.
| Compound Name | [(E,4S)-2-oxonon-5-en-4-yl] (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 160517729 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | [(E,4S)-2-oxonon-5-en-4-yl] (2R)-2-amino-3-methylbutanoate |
| SMILES | CCC/C=C/[C@H](CC(C)=O)OC(=O)[C@H](N)C(C)C |
| InChI | InChI=1S/C14H25NO3/c1-5-6-7-8-12(9-11(4)16)18-14(17)13(15)10(2)3/h7-8,10,12-13H,5-6,9,15H2,1-4H3/b8-7+/t12-,13-/m1/s1 |
| InChIKey | TVQVQRUYJHMNJJ-WUOSCTTQSA-N |
| XLogP | 2.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|