About 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate
1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate (PubChem CID 54205503) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate |
| PubChem CID | 54205503 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate |
| SMILES | CCCCC(C=O)OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C11H21NO3/c1-4-5-6-9(7-13)15-11(14)10(12)8(2)3/h7-10H,4-6,12H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | GSUFWDIMGXVGKL-AXDSSHIGSA-N |
| XLogP | 1.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate?
The IUPAC name of 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate (CID 54205503) is 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate.
What is the SMILES notation for 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate?
The canonical SMILES for 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate is CCCCC(C=O)OC(=O)[C@@H](N)C(C)C.
What is the InChIKey of 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate?
The InChIKey is GSUFWDIMGXVGKL-AXDSSHIGSA-N. The full InChI is InChI=1S/C11H21NO3/c1-4-5-6-9(7-13)15-11(14)10(12)8(2)3/h7-10H,4-6,12H2,1-3H3/t9?,10-/m0/s1.
What are the key properties of 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate?
1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate has a molecular weight of 215.29 g/mol, XLogP of 1.27, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxohexan-2-yl (2S)-2-amino-3-methylbutanoate is sourced from PubChem (CID 54205503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).