C24H43NO5S — CID 25067782
tert-butyl (E,3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-octanoylsulfanylhept-4-enoate (PubChem CID 25067782) has the molecular formula C24H43NO5S and a molecular weight of 457.68 g/mol. Its IUPAC name is tert-butyl (E,3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-octanoylsulfanylhept-4-enoate.
| Compound Name | tert-butyl (E,3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-octanoylsulfanylhept-4-enoate |
|---|---|
| PubChem CID | 25067782 |
| Molecular Formula | C24H43NO5S |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | tert-butyl (E,3S)-3-[(2S)-2-amino-3-methylbutanoyl]oxy-7-octanoylsulfanylhept-4-enoate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@H](CC(=O)OC(C)(C)C)OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C24H43NO5S/c1-7-8-9-10-11-15-21(27)31-16-13-12-14-19(17-20(26)30-24(4,5)6)29-23(28)22(25)18(2)3/h12,14,18-19,22H,7-11,13,15-17,25H2,1-6H3/b14-12+/t19-,22+/m1/s1 |
| InChIKey | OKZKKJLUWWQYES-HCZOABNBSA-N |
| XLogP | 5.18 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|