C14H17FN4O4 — CID 138486023
(2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]propanoic acid (PubChem CID 138486023) has the molecular formula C14H17FN4O4 and a molecular weight of 324.31 g/mol. Its IUPAC name is (2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 138486023 |
| Molecular Formula | C14H17FN4O4 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (2S)-2-[[(Z)-2-[[6-(aminomethyl)-3-fluoropyridine-2-carbonyl]amino]but-2-enoyl]amino]propanoic acid |
| SMILES | C/C=C(\NC(=O)c1nc(CN)ccc1F)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H17FN4O4/c1-3-10(12(20)17-7(2)14(22)23)19-13(21)11-9(15)5-4-8(6-16)18-11/h3-5,7H,6,16H2,1-2H3,(H,17,20)(H,19,21)(H,22,23)/b10-3-/t7-/m0/s1 |
| InChIKey | BIRJSLSRRDXFNH-XXEXGREUSA-N |
| XLogP | -0.10 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|