C7H11FN2O2 — CID 158251621
3-amino-5-fluoro-1H-pyridin-2-one;ethanol (PubChem CID 158251621) has the molecular formula C7H11FN2O2 and a molecular weight of 174.17 g/mol. Its IUPAC name is 3-amino-5-fluoro-1H-pyridin-2-one;ethanol.
| Compound Name | 3-amino-5-fluoro-1H-pyridin-2-one;ethanol |
|---|---|
| PubChem CID | 158251621 |
| Molecular Formula | C7H11FN2O2 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3-amino-5-fluoro-1H-pyridin-2-one;ethanol |
| SMILES | CCO.Nc1cc(F)c[nH]c1=O |
| InChI | InChI=1S/C5H5FN2O.C2H6O/c6-3-1-4(7)5(9)8-2-3;1-2-3/h1-2H,7H2,(H,8,9);3H,2H2,1H3 |
| InChIKey | GGTZPNJHHMEPAT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |