C22H21FN4O3S — CID 158254901
5-[2-fluoro-4-(2-methoxyethoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one (PubChem CID 158254901) has the molecular formula C22H21FN4O3S and a molecular weight of 440.50 g/mol. Its IUPAC name is 5-[2-fluoro-4-(2-methoxyethoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one.
| Compound Name | 5-[2-fluoro-4-(2-methoxyethoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
|---|---|
| PubChem CID | 158254901 |
| Molecular Formula | C22H21FN4O3S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 5-[2-fluoro-4-(2-methoxyethoxy)phenyl]-7-(6-isocyano-5-methyl-3-pyridinyl)-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
| SMILES | [C-]#[N+]c1ncc(N2C(=O)C3(CCC3)N(c3ccc(OCCOC)cc3F)C2=S)cc1C |
| InChI | InChI=1S/C22H21FN4O3S/c1-14-11-15(13-25-19(14)24-2)26-20(28)22(7-4-8-22)27(21(26)31)18-6-5-16(12-17(18)23)30-10-9-29-3/h5-6,11-13H,4,7-10H2,1,3H3 |
| InChIKey | GHDWZQRBFHPRIQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 59.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|