About 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine
6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine (PubChem CID 158258339) has the molecular formula C29H26N6
and a molecular weight of 458.57 g/mol. Its IUPAC name is 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine.
Molecular Properties
| Compound Name | 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine |
| PubChem CID | 158258339 |
| Molecular Formula | C29H26N6 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine |
| SMILES | Cn1ccc2ccc(CN)cc21.[C-]#[N+]c1ccc2cc[nH]c2c1.[C-]#[N+]c1ccc2ccn(C)c2c1 |
| InChI | InChI=1S/C10H8N2.C10H12N2.C9H6N2/c1-11-9-4-3-8-5-6-12(2)10(8)7-9;1-12-5-4-9-3-2-8(7-11)6-10(9)12;1-10-8-3-2-7-4-5-11-9(7)6-8/h3-7H,2H3;2-6H,7,11H2,1H3;2-6,11H |
| InChIKey | GHOFMOFKHHDMEH-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine?
The IUPAC name of 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine (CID 158258339) is 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine.
What is the SMILES notation for 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine?
The canonical SMILES for 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine is Cn1ccc2ccc(CN)cc21.[C-]#[N+]c1ccc2cc[nH]c2c1.[C-]#[N+]c1ccc2ccn(C)c2c1.
What is the InChIKey of 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine?
The InChIKey is GHOFMOFKHHDMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C10H12N2.C9H6N2/c1-11-9-4-3-8-5-6-12(2)10(8)7-9;1-12-5-4-9-3-2-8(7-11)6-10(9)12;1-10-8-3-2-7-4-5-11-9(7)6-8/h3-7H,2H3;2-6H,7,11H2,1H3;2-6,11H.
What are the key properties of 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine?
6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine has a molecular weight of 458.57 g/mol, XLogP of 7.08, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isocyano-1H-indole;6-isocyano-1-methylindole;(1-methylindol-6-yl)methanamine is sourced from PubChem (CID 158258339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).