C16H10Cl6N2O5S2 — CID 158258905
6,7-dichloro-1H-indole;6,7-dichloro-1H-indole-3-sulfonyl chloride;sulfurochloridic acid (PubChem CID 158258905) has the molecular formula C16H10Cl6N2O5S2 and a molecular weight of 587.12 g/mol. Its IUPAC name is 6,7-dichloro-1H-indole;6,7-dichloro-1H-indole-3-sulfonyl chloride;sulfurochloridic acid.
| Compound Name | 6,7-dichloro-1H-indole;6,7-dichloro-1H-indole-3-sulfonyl chloride;sulfurochloridic acid |
|---|---|
| PubChem CID | 158258905 |
| Molecular Formula | C16H10Cl6N2O5S2 |
| Molecular Weight | 587.12 g/mol |
| Exact Mass | 583.82 |
| IUPAC Name | 6,7-dichloro-1H-indole;6,7-dichloro-1H-indole-3-sulfonyl chloride;sulfurochloridic acid |
| SMILES | Clc1ccc2cc[nH]c2c1Cl.O=S(=O)(Cl)c1c[nH]c2c(Cl)c(Cl)ccc12.O=S(=O)(O)Cl |
| InChI | InChI=1S/C8H4Cl3NO2S.C8H5Cl2N.ClHO3S/c9-5-2-1-4-6(15(11,13)14)3-12-8(4)7(5)10;9-6-2-1-5-3-4-11-8(5)7(6)10;1-5(2,3)4/h1-3,12H;1-4,11H;(H,2,3,4) |
| InChIKey | GHQADFMCLQIHHN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.12 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|