C8H4Cl3NO2S — CID 82374063
4,7-dichloro-1H-indole-3-sulfonyl chloride (PubChem CID 82374063) has the molecular formula C8H4Cl3NO2S and a molecular weight of 284.55 g/mol. Its IUPAC name is 4,7-dichloro-1H-indole-3-sulfonyl chloride.
| Compound Name | 4,7-dichloro-1H-indole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 82374063 |
| Molecular Formula | C8H4Cl3NO2S |
| Molecular Weight | 284.55 g/mol |
| Exact Mass | 282.90 |
| IUPAC Name | 4,7-dichloro-1H-indole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c[nH]c2c(Cl)ccc(Cl)c12 |
| InChI | InChI=1S/C8H4Cl3NO2S/c9-4-1-2-5(10)8-7(4)6(3-12-8)15(11,13)14/h1-3,12H |
| InChIKey | NHIHMDATOKDAGF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |