C21H27NO5 — CID 158260809
2-[3-(methoxymethoxy)-4-methylphenyl]acetonitrile;[3-(methoxymethoxy)-4-methylphenyl]methanol (PubChem CID 158260809) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[3-(methoxymethoxy)-4-methylphenyl]acetonitrile;[3-(methoxymethoxy)-4-methylphenyl]methanol.
| Compound Name | 2-[3-(methoxymethoxy)-4-methylphenyl]acetonitrile;[3-(methoxymethoxy)-4-methylphenyl]methanol |
|---|---|
| PubChem CID | 158260809 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[3-(methoxymethoxy)-4-methylphenyl]acetonitrile;[3-(methoxymethoxy)-4-methylphenyl]methanol |
| SMILES | COCOc1cc(CC#N)ccc1C.COCOc1cc(CO)ccc1C |
| InChI | InChI=1S/C11H13NO2.C10H14O3/c1-9-3-4-10(5-6-12)7-11(9)14-8-13-2;1-8-3-4-9(6-11)5-10(8)13-7-12-2/h3-4,7H,5,8H2,1-2H3;3-5,11H,6-7H2,1-2H3 |
| InChIKey | GHVTYTWJWQHDKT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|