C47H48N2 — CID 158260916
4-[(E)-2-[4-[(E)-2-[4-(3,6-dihexylcarbazol-9-yl)phenyl]ethenyl]phenyl]ethenyl]benzonitrile (PubChem CID 158260916) has the molecular formula C47H48N2 and a molecular weight of 640.92 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-[4-(3,6-dihexylcarbazol-9-yl)phenyl]ethenyl]phenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[4-[(E)-2-[4-(3,6-dihexylcarbazol-9-yl)phenyl]ethenyl]phenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 158260916 |
| Molecular Formula | C47H48N2 |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-[4-(3,6-dihexylcarbazol-9-yl)phenyl]ethenyl]phenyl]ethenyl]benzonitrile |
| SMILES | CCCCCCc1ccc2c(c1)c1cc(CCCCCC)ccc1n2-c1ccc(/C=C/c2ccc(/C=C/c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H48N2/c1-3-5-7-9-11-40-27-31-46-44(33-40)45-34-41(12-10-8-6-4-2)28-32-47(45)49(46)43-29-25-39(26-30-43)20-19-37-15-13-36(14-16-37)17-18-38-21-23-42(35-48)24-22-38/h13-34H,3-12H2,1-2H3/b18-17+,20-19+ |
| InChIKey | ZGSQZGMXILIENW-GHPQSQKNSA-N |
| XLogP | 13.24 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|