C48H46N2 — CID 88901550
2,8-bis[(E)-2-(4-hexylphenyl)ethenyl]chrysene-6,12-dicarbonitrile (PubChem CID 88901550) has the molecular formula C48H46N2 and a molecular weight of 650.91 g/mol. Its IUPAC name is 2,8-bis[(E)-2-(4-hexylphenyl)ethenyl]chrysene-6,12-dicarbonitrile.
| Compound Name | 2,8-bis[(E)-2-(4-hexylphenyl)ethenyl]chrysene-6,12-dicarbonitrile |
|---|---|
| PubChem CID | 88901550 |
| Molecular Formula | C48H46N2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | 2,8-bis[(E)-2-(4-hexylphenyl)ethenyl]chrysene-6,12-dicarbonitrile |
| SMILES | CCCCCCc1ccc(/C=C/c2ccc3c(c2)c(C#N)cc2c4ccc(/C=C/c5ccc(CCCCCC)cc5)cc4c(C#N)cc32)cc1 |
| InChI | InChI=1S/C48H46N2/c1-3-5-7-9-11-35-13-17-37(18-14-35)21-23-39-25-27-43-45(29-39)41(33-49)31-48-44-28-26-40(30-46(44)42(34-50)32-47(43)48)24-22-38-19-15-36(16-20-38)12-10-8-6-4-2/h13-32H,3-12H2,1-2H3/b23-21+,24-22+ |
| InChIKey | DMMMCCFXEHQRRH-MBALSZOMSA-N |
| XLogP | 13.48 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|