C30H48N2O6 — CID 158263569
tert-butyl 2-[6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 158263569) has the molecular formula C30H48N2O6 and a molecular weight of 532.72 g/mol. Its IUPAC name is tert-butyl 2-[6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 158263569 |
| Molecular Formula | C30H48N2O6 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | tert-butyl 2-[6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;tert-butyl 2-[3-methyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CC1=CC2C(C1)CC2(CC(=O)OC(C)(C)C)C[N+](=O)[O-].CC1=CC2C(C1)CC2(CN)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO4.C15H25NO2/c1-10-5-11-7-15(9-16(18)19,12(11)6-10)8-13(17)20-14(2,3)4;1-10-5-11-7-15(9-16,12(11)6-10)8-13(17)18-14(2,3)4/h6,11-12H,5,7-9H2,1-4H3;6,11-12H,5,7-9,16H2,1-4H3 |
| InChIKey | GIEAPUGINCRJPU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|