C16H25NO4 — CID 91524495
tert-butyl 2-[(1S,5R,6S)-2-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 91524495) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 2-[(1S,5R,6S)-2-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | tert-butyl 2-[(1S,5R,6S)-2-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 91524495 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl 2-[(1S,5R,6S)-2-ethyl-6-(nitromethyl)-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CCC1C=C[C@@H]2[C@H]1C[C@@]2(CC(=O)OC(C)(C)C)C[N+](=O)[O-] |
| InChI | InChI=1S/C16H25NO4/c1-5-11-6-7-13-12(11)8-16(13,10-17(19)20)9-14(18)21-15(2,3)4/h6-7,11-13H,5,8-10H2,1-4H3/t11?,12-,13+,16+/m0/s1 |
| InChIKey | WTLBXRXMRLHKQH-YVAZLZIHSA-N |
| XLogP | 3.21 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|