C20H40N2 — CID 158264984
4-tert-butyl-1-methyl-3,6-dihydro-2H-pyridine;4-tert-butyl-1-methylpiperidine (PubChem CID 158264984) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 4-tert-butyl-1-methyl-3,6-dihydro-2H-pyridine;4-tert-butyl-1-methylpiperidine.
| Compound Name | 4-tert-butyl-1-methyl-3,6-dihydro-2H-pyridine;4-tert-butyl-1-methylpiperidine |
|---|---|
| PubChem CID | 158264984 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 4-tert-butyl-1-methyl-3,6-dihydro-2H-pyridine;4-tert-butyl-1-methylpiperidine |
| SMILES | CN1CC=C(C(C)(C)C)CC1.CN1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C10H21N.C10H19N/c2*1-10(2,3)9-5-7-11(4)8-6-9/h9H,5-8H2,1-4H3;5H,6-8H2,1-4H3 |
| InChIKey | GIICWKLLGFYQDI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|