C21H39N — CID 57239417
3-methyl-1-[2-methyl-3-[4-(2-methylbutan-2-yl)cyclohexyl]prop-2-enyl]piperidine (PubChem CID 57239417) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is 3-methyl-1-[2-methyl-3-[4-(2-methylbutan-2-yl)cyclohexyl]prop-2-enyl]piperidine.
| Compound Name | 3-methyl-1-[2-methyl-3-[4-(2-methylbutan-2-yl)cyclohexyl]prop-2-enyl]piperidine |
|---|---|
| PubChem CID | 57239417 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | 3-methyl-1-[2-methyl-3-[4-(2-methylbutan-2-yl)cyclohexyl]prop-2-enyl]piperidine |
| SMILES | CCC(C)(C)C1CCC(C=C(C)CN2CCCC(C)C2)CC1 |
| InChI | InChI=1S/C21H39N/c1-6-21(4,5)20-11-9-19(10-12-20)14-18(3)16-22-13-7-8-17(2)15-22/h14,17,19-20H,6-13,15-16H2,1-5H3 |
| InChIKey | MMCLDSSBDRSYOB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|