C17H26FN — CID 130371386
(9Z)-9-[(E)-2-fluoropent-2-enylidene]-3-methyl-10-methylidene-3-azaspiro[5.5]undecane (PubChem CID 130371386) has the molecular formula C17H26FN and a molecular weight of 263.40 g/mol. Its IUPAC name is (9Z)-9-[(E)-2-fluoropent-2-enylidene]-3-methyl-10-methylidene-3-azaspiro[5.5]undecane.
| Compound Name | (9Z)-9-[(E)-2-fluoropent-2-enylidene]-3-methyl-10-methylidene-3-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 130371386 |
| Molecular Formula | C17H26FN |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (9Z)-9-[(E)-2-fluoropent-2-enylidene]-3-methyl-10-methylidene-3-azaspiro[5.5]undecane |
| SMILES | C=C1CC2(CC/C1=C/C(F)=C\CC)CCN(C)CC2 |
| InChI | InChI=1S/C17H26FN/c1-4-5-16(18)12-15-6-7-17(13-14(15)2)8-10-19(3)11-9-17/h5,12H,2,4,6-11,13H2,1,3H3/b15-12-,16-5+ |
| InChIKey | MDRZICOQDMTOMF-GJFCQGFISA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |