C16H23F5N2 — CID 142853165
1-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]methyl]-4-methylpiperazine (PubChem CID 142853165) has the molecular formula C16H23F5N2 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142853165 |
| Molecular Formula | C16H23F5N2 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]methyl]-4-methylpiperazine |
| SMILES | CC1=CC=C(C(F)(F)C(F)(F)F)C(C)(CN2CCN(C)CC2)C1 |
| InChI | InChI=1S/C16H23F5N2/c1-12-4-5-13(15(17,18)16(19,20)21)14(2,10-12)11-23-8-6-22(3)7-9-23/h4-5H,6-11H2,1-3H3 |
| InChIKey | UUAKBWLZFMQZAS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|