C30H30F6N6O2 — CID 158266629
1-[(4-nitrophenyl)methyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole;4-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]aniline (PubChem CID 158266629) has the molecular formula C30H30F6N6O2 and a molecular weight of 620.60 g/mol. Its IUPAC name is 1-[(4-nitrophenyl)methyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole;4-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]aniline.
| Compound Name | 1-[(4-nitrophenyl)methyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole;4-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 158266629 |
| Molecular Formula | C30H30F6N6O2 |
| Molecular Weight | 620.60 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | 1-[(4-nitrophenyl)methyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole;4-[[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]methyl]aniline |
| SMILES | Nc1ccc(Cn2nc(C(F)(F)F)c3c2CCCC3)cc1.O=[N+]([O-])c1ccc(Cn2nc(C(F)(F)F)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C15H14F3N3O2.C15H16F3N3/c16-15(17,18)14-12-3-1-2-4-13(12)20(19-14)9-10-5-7-11(8-6-10)21(22)23;16-15(17,18)14-12-3-1-2-4-13(12)21(20-14)9-10-5-7-11(19)8-6-10/h5-8H,1-4,9H2;5-8H,1-4,9,19H2 |
| InChIKey | GINGFEOUPRYAED-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|